C20H24ClN5O3 — CID 1029630
(4-chloro-3-nitrophenyl)-[4-(2,6-dimethyl-5-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]methanone (PubChem CID 1029630) has the molecular formula C20H24ClN5O3 and a molecular weight of 417.90 g/mol. Its IUPAC name is (4-chloro-3-nitrophenyl)-[4-(2,6-dimethyl-5-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]methanone.
| Compound Name | (4-chloro-3-nitrophenyl)-[4-(2,6-dimethyl-5-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 1029630 |
| Molecular Formula | C20H24ClN5O3 |
| Molecular Weight | 417.90 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | (4-chloro-3-nitrophenyl)-[4-(2,6-dimethyl-5-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]methanone |
| SMILES | Cc1nc(C)c(C(C)C)c(N2CCN(C(=O)c3ccc(Cl)c([N+](=O)[O-])c3)CC2)n1 |
| InChI | InChI=1S/C20H24ClN5O3/c1-12(2)18-13(3)22-14(4)23-19(18)24-7-9-25(10-8-24)20(27)15-5-6-16(21)17(11-15)26(28)29/h5-6,11-12H,7-10H2,1-4H3 |
| InChIKey | KQSFIFZBIYVTIV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 92.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.90 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|