C25H36N4O2 — CID 42775012
(4-butoxyphenyl)-[4-(2,6-dimethyl-5-propan-2-ylpyrimidin-4-yl)-1,4-diazepan-1-yl]methanone (PubChem CID 42775012) has the molecular formula C25H36N4O2 and a molecular weight of 424.59 g/mol. Its IUPAC name is (4-butoxyphenyl)-[4-(2,6-dimethyl-5-propan-2-ylpyrimidin-4-yl)-1,4-diazepan-1-yl]methanone.
| Compound Name | (4-butoxyphenyl)-[4-(2,6-dimethyl-5-propan-2-ylpyrimidin-4-yl)-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 42775012 |
| Molecular Formula | C25H36N4O2 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | (4-butoxyphenyl)-[4-(2,6-dimethyl-5-propan-2-ylpyrimidin-4-yl)-1,4-diazepan-1-yl]methanone |
| SMILES | CCCCOc1ccc(C(=O)N2CCCN(c3nc(C)nc(C)c3C(C)C)CC2)cc1 |
| InChI | InChI=1S/C25H36N4O2/c1-6-7-17-31-22-11-9-21(10-12-22)25(30)29-14-8-13-28(15-16-29)24-23(18(2)3)19(4)26-20(5)27-24/h9-12,18H,6-8,13-17H2,1-5H3 |
| InChIKey | VIVHDMVGZDFJHB-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|