C25H36N4O — CID 3518480
1-[4-(6-methyl-2-phenyl-5-propan-2-ylpyrimidin-4-yl)-1,4-diazepan-1-yl]hexan-1-one (PubChem CID 3518480) has the molecular formula C25H36N4O and a molecular weight of 408.59 g/mol. Its IUPAC name is 1-[4-(6-methyl-2-phenyl-5-propan-2-ylpyrimidin-4-yl)-1,4-diazepan-1-yl]hexan-1-one.
| Compound Name | 1-[4-(6-methyl-2-phenyl-5-propan-2-ylpyrimidin-4-yl)-1,4-diazepan-1-yl]hexan-1-one |
|---|---|
| PubChem CID | 3518480 |
| Molecular Formula | C25H36N4O |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | 1-[4-(6-methyl-2-phenyl-5-propan-2-ylpyrimidin-4-yl)-1,4-diazepan-1-yl]hexan-1-one |
| SMILES | CCCCCC(=O)N1CCCN(c2nc(-c3ccccc3)nc(C)c2C(C)C)CC1 |
| InChI | InChI=1S/C25H36N4O/c1-5-6-8-14-22(30)28-15-11-16-29(18-17-28)25-23(19(2)3)20(4)26-24(27-25)21-12-9-7-10-13-21/h7,9-10,12-13,19H,5-6,8,11,14-18H2,1-4H3 |
| InChIKey | DZXKNVZQPGSNAE-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|