C20H34N4O — CID 4133753
1-[4-(2,6-dimethyl-5-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]heptan-1-one (PubChem CID 4133753) has the molecular formula C20H34N4O and a molecular weight of 346.52 g/mol. Its IUPAC name is 1-[4-(2,6-dimethyl-5-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]heptan-1-one.
| Compound Name | 1-[4-(2,6-dimethyl-5-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]heptan-1-one |
|---|---|
| PubChem CID | 4133753 |
| Molecular Formula | C20H34N4O |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.27 |
| IUPAC Name | 1-[4-(2,6-dimethyl-5-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]heptan-1-one |
| SMILES | CCCCCCC(=O)N1CCN(c2nc(C)nc(C)c2C(C)C)CC1 |
| InChI | InChI=1S/C20H34N4O/c1-6-7-8-9-10-18(25)23-11-13-24(14-12-23)20-19(15(2)3)16(4)21-17(5)22-20/h15H,6-14H2,1-5H3 |
| InChIKey | SFDRIGJNORKIIT-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|