C25H35ClN4O — CID 5190621
1-[4-[5-[(4-chlorophenyl)methyl]-2,6-dimethylpyrimidin-4-yl]-1,4-diazepan-1-yl]heptan-1-one (PubChem CID 5190621) has the molecular formula C25H35ClN4O and a molecular weight of 443.04 g/mol. Its IUPAC name is 1-[4-[5-[(4-chlorophenyl)methyl]-2,6-dimethylpyrimidin-4-yl]-1,4-diazepan-1-yl]heptan-1-one.
| Compound Name | 1-[4-[5-[(4-chlorophenyl)methyl]-2,6-dimethylpyrimidin-4-yl]-1,4-diazepan-1-yl]heptan-1-one |
|---|---|
| PubChem CID | 5190621 |
| Molecular Formula | C25H35ClN4O |
| Molecular Weight | 443.04 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | 1-[4-[5-[(4-chlorophenyl)methyl]-2,6-dimethylpyrimidin-4-yl]-1,4-diazepan-1-yl]heptan-1-one |
| SMILES | CCCCCCC(=O)N1CCCN(c2nc(C)nc(C)c2Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C25H35ClN4O/c1-4-5-6-7-9-24(31)29-14-8-15-30(17-16-29)25-23(19(2)27-20(3)28-25)18-21-10-12-22(26)13-11-21/h10-13H,4-9,14-18H2,1-3H3 |
| InChIKey | ICFSUQGDFNKRQG-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.04 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|