C31H40N4O — CID 3318799
[4-[2,6-dimethyl-5-[(4-methylphenyl)methyl]pyrimidin-4-yl]-1,4-diazepan-1-yl]-(4-pentylphenyl)methanone (PubChem CID 3318799) has the molecular formula C31H40N4O and a molecular weight of 484.69 g/mol. Its IUPAC name is [4-[2,6-dimethyl-5-[(4-methylphenyl)methyl]pyrimidin-4-yl]-1,4-diazepan-1-yl]-(4-pentylphenyl)methanone.
| Compound Name | [4-[2,6-dimethyl-5-[(4-methylphenyl)methyl]pyrimidin-4-yl]-1,4-diazepan-1-yl]-(4-pentylphenyl)methanone |
|---|---|
| PubChem CID | 3318799 |
| Molecular Formula | C31H40N4O |
| Molecular Weight | 484.69 g/mol |
| Exact Mass | 484.32 |
| IUPAC Name | [4-[2,6-dimethyl-5-[(4-methylphenyl)methyl]pyrimidin-4-yl]-1,4-diazepan-1-yl]-(4-pentylphenyl)methanone |
| SMILES | CCCCCc1ccc(C(=O)N2CCCN(c3nc(C)nc(C)c3Cc3ccc(C)cc3)CC2)cc1 |
| InChI | InChI=1S/C31H40N4O/c1-5-6-7-9-26-14-16-28(17-15-26)31(36)35-19-8-18-34(20-21-35)30-29(24(3)32-25(4)33-30)22-27-12-10-23(2)11-13-27/h10-17H,5-9,18-22H2,1-4H3 |
| InChIKey | GWIRKAGTTSWXTE-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.69 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|