C26H29N5O3 — CID 1027132
[4-[2,6-dimethyl-5-[(4-methylphenyl)methyl]pyrimidin-4-yl]-1,4-diazepan-1-yl]-(4-nitrophenyl)methanone (PubChem CID 1027132) has the molecular formula C26H29N5O3 and a molecular weight of 459.55 g/mol. Its IUPAC name is [4-[2,6-dimethyl-5-[(4-methylphenyl)methyl]pyrimidin-4-yl]-1,4-diazepan-1-yl]-(4-nitrophenyl)methanone.
| Compound Name | [4-[2,6-dimethyl-5-[(4-methylphenyl)methyl]pyrimidin-4-yl]-1,4-diazepan-1-yl]-(4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 1027132 |
| Molecular Formula | C26H29N5O3 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | [4-[2,6-dimethyl-5-[(4-methylphenyl)methyl]pyrimidin-4-yl]-1,4-diazepan-1-yl]-(4-nitrophenyl)methanone |
| SMILES | Cc1ccc(Cc2c(C)nc(C)nc2N2CCCN(C(=O)c3ccc([N+](=O)[O-])cc3)CC2)cc1 |
| InChI | InChI=1S/C26H29N5O3/c1-18-5-7-21(8-6-18)17-24-19(2)27-20(3)28-25(24)29-13-4-14-30(16-15-29)26(32)22-9-11-23(12-10-22)31(33)34/h5-12H,4,13-17H2,1-3H3 |
| InChIKey | NROBRRCWKKVIJA-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 92.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|