C26H29N5O5 — CID 42802089
(2,4-dimethoxyphenyl)-[4-[2,6-dimethyl-5-[(4-nitrophenyl)methyl]pyrimidin-4-yl]piperazin-1-yl]methanone (PubChem CID 42802089) has the molecular formula C26H29N5O5 and a molecular weight of 491.55 g/mol. Its IUPAC name is (2,4-dimethoxyphenyl)-[4-[2,6-dimethyl-5-[(4-nitrophenyl)methyl]pyrimidin-4-yl]piperazin-1-yl]methanone.
| Compound Name | (2,4-dimethoxyphenyl)-[4-[2,6-dimethyl-5-[(4-nitrophenyl)methyl]pyrimidin-4-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 42802089 |
| Molecular Formula | C26H29N5O5 |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | (2,4-dimethoxyphenyl)-[4-[2,6-dimethyl-5-[(4-nitrophenyl)methyl]pyrimidin-4-yl]piperazin-1-yl]methanone |
| SMILES | COc1ccc(C(=O)N2CCN(c3nc(C)nc(C)c3Cc3ccc([N+](=O)[O-])cc3)CC2)c(OC)c1 |
| InChI | InChI=1S/C26H29N5O5/c1-17-23(15-19-5-7-20(8-6-19)31(33)34)25(28-18(2)27-17)29-11-13-30(14-12-29)26(32)22-10-9-21(35-3)16-24(22)36-4/h5-10,16H,11-15H2,1-4H3 |
| InChIKey | HQODTSRSQLUPGP-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 110.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|