C25H25Cl2N5O3 — CID 3704563
(2-chloro-4-nitrophenyl)-[4-[5-[(4-chlorophenyl)methyl]-2,6-dimethylpyrimidin-4-yl]-1,4-diazepan-1-yl]methanone (PubChem CID 3704563) has the molecular formula C25H25Cl2N5O3 and a molecular weight of 514.41 g/mol. Its IUPAC name is (2-chloro-4-nitrophenyl)-[4-[5-[(4-chlorophenyl)methyl]-2,6-dimethylpyrimidin-4-yl]-1,4-diazepan-1-yl]methanone.
| Compound Name | (2-chloro-4-nitrophenyl)-[4-[5-[(4-chlorophenyl)methyl]-2,6-dimethylpyrimidin-4-yl]-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 3704563 |
| Molecular Formula | C25H25Cl2N5O3 |
| Molecular Weight | 514.41 g/mol |
| Exact Mass | 513.13 |
| IUPAC Name | (2-chloro-4-nitrophenyl)-[4-[5-[(4-chlorophenyl)methyl]-2,6-dimethylpyrimidin-4-yl]-1,4-diazepan-1-yl]methanone |
| SMILES | Cc1nc(C)c(Cc2ccc(Cl)cc2)c(N2CCCN(C(=O)c3ccc([N+](=O)[O-])cc3Cl)CC2)n1 |
| InChI | InChI=1S/C25H25Cl2N5O3/c1-16-22(14-18-4-6-19(26)7-5-18)24(29-17(2)28-16)30-10-3-11-31(13-12-30)25(33)21-9-8-20(32(34)35)15-23(21)27/h4-9,15H,3,10-14H2,1-2H3 |
| InChIKey | VMFXKTCRVBKBOW-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 92.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.41 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|