C25H27N5O3 — CID 1027182
[4-(5-benzyl-2,6-dimethylpyrimidin-4-yl)-1,4-diazepan-1-yl]-(3-nitrophenyl)methanone (PubChem CID 1027182) has the molecular formula C25H27N5O3 and a molecular weight of 445.52 g/mol. Its IUPAC name is [4-(5-benzyl-2,6-dimethylpyrimidin-4-yl)-1,4-diazepan-1-yl]-(3-nitrophenyl)methanone.
| Compound Name | [4-(5-benzyl-2,6-dimethylpyrimidin-4-yl)-1,4-diazepan-1-yl]-(3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 1027182 |
| Molecular Formula | C25H27N5O3 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | [4-(5-benzyl-2,6-dimethylpyrimidin-4-yl)-1,4-diazepan-1-yl]-(3-nitrophenyl)methanone |
| SMILES | Cc1nc(C)c(Cc2ccccc2)c(N2CCCN(C(=O)c3cccc([N+](=O)[O-])c3)CC2)n1 |
| InChI | InChI=1S/C25H27N5O3/c1-18-23(16-20-8-4-3-5-9-20)24(27-19(2)26-18)28-12-7-13-29(15-14-28)25(31)21-10-6-11-22(17-21)30(32)33/h3-6,8-11,17H,7,12-16H2,1-2H3 |
| InChIKey | FQADFSRAMINSSZ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 92.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|