C25H26N6O5 — CID 5101787
[4-(5-benzyl-6-ethyl-2-methylpyrimidin-4-yl)piperazin-1-yl]-(3,5-dinitrophenyl)methanone (PubChem CID 5101787) has the molecular formula C25H26N6O5 and a molecular weight of 490.52 g/mol. Its IUPAC name is [4-(5-benzyl-6-ethyl-2-methylpyrimidin-4-yl)piperazin-1-yl]-(3,5-dinitrophenyl)methanone.
| Compound Name | [4-(5-benzyl-6-ethyl-2-methylpyrimidin-4-yl)piperazin-1-yl]-(3,5-dinitrophenyl)methanone |
|---|---|
| PubChem CID | 5101787 |
| Molecular Formula | C25H26N6O5 |
| Molecular Weight | 490.52 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | [4-(5-benzyl-6-ethyl-2-methylpyrimidin-4-yl)piperazin-1-yl]-(3,5-dinitrophenyl)methanone |
| SMILES | CCc1nc(C)nc(N2CCN(C(=O)c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)CC2)c1Cc1ccccc1 |
| InChI | InChI=1S/C25H26N6O5/c1-3-23-22(13-18-7-5-4-6-8-18)24(27-17(2)26-23)28-9-11-29(12-10-28)25(32)19-14-20(30(33)34)16-21(15-19)31(35)36/h4-8,14-16H,3,9-13H2,1-2H3 |
| InChIKey | MHAZJAMVQUSOKX-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 135.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.52 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|