C26H31N5O — CID 5151861
N-benzyl-4-(5-benzyl-6-ethyl-2-methylpyrimidin-4-yl)piperazine-1-carboxamide (PubChem CID 5151861) has the molecular formula C26H31N5O and a molecular weight of 429.57 g/mol. Its IUPAC name is N-benzyl-4-(5-benzyl-6-ethyl-2-methylpyrimidin-4-yl)piperazine-1-carboxamide.
| Compound Name | N-benzyl-4-(5-benzyl-6-ethyl-2-methylpyrimidin-4-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 5151861 |
| Molecular Formula | C26H31N5O |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | N-benzyl-4-(5-benzyl-6-ethyl-2-methylpyrimidin-4-yl)piperazine-1-carboxamide |
| SMILES | CCc1nc(C)nc(N2CCN(C(=O)NCc3ccccc3)CC2)c1Cc1ccccc1 |
| InChI | InChI=1S/C26H31N5O/c1-3-24-23(18-21-10-6-4-7-11-21)25(29-20(2)28-24)30-14-16-31(17-15-30)26(32)27-19-22-12-8-5-9-13-22/h4-13H,3,14-19H2,1-2H3,(H,27,32) |
| InChIKey | SFVHHHCOXJYKNC-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |