C25H27BrN4O — CID 1027502
[4-(5-benzyl-6-ethyl-2-methylpyrimidin-4-yl)piperazin-1-yl]-(4-bromophenyl)methanone (PubChem CID 1027502) has the molecular formula C25H27BrN4O and a molecular weight of 479.42 g/mol. Its IUPAC name is [4-(5-benzyl-6-ethyl-2-methylpyrimidin-4-yl)piperazin-1-yl]-(4-bromophenyl)methanone.
| Compound Name | [4-(5-benzyl-6-ethyl-2-methylpyrimidin-4-yl)piperazin-1-yl]-(4-bromophenyl)methanone |
|---|---|
| PubChem CID | 1027502 |
| Molecular Formula | C25H27BrN4O |
| Molecular Weight | 479.42 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | [4-(5-benzyl-6-ethyl-2-methylpyrimidin-4-yl)piperazin-1-yl]-(4-bromophenyl)methanone |
| SMILES | CCc1nc(C)nc(N2CCN(C(=O)c3ccc(Br)cc3)CC2)c1Cc1ccccc1 |
| InChI | InChI=1S/C25H27BrN4O/c1-3-23-22(17-19-7-5-4-6-8-19)24(28-18(2)27-23)29-13-15-30(16-14-29)25(31)20-9-11-21(26)12-10-20/h4-12H,3,13-17H2,1-2H3 |
| InChIKey | XEVFKBJXOPWDOE-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.42 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |