C26H29ClN4O — CID 4193737
1-[4-(5-benzyl-6-ethyl-2-methylpyrimidin-4-yl)piperazin-1-yl]-2-chloro-2-phenylethanone (PubChem CID 4193737) has the molecular formula C26H29ClN4O and a molecular weight of 449.00 g/mol. Its IUPAC name is 1-[4-(5-benzyl-6-ethyl-2-methylpyrimidin-4-yl)piperazin-1-yl]-2-chloro-2-phenylethanone.
| Compound Name | 1-[4-(5-benzyl-6-ethyl-2-methylpyrimidin-4-yl)piperazin-1-yl]-2-chloro-2-phenylethanone |
|---|---|
| PubChem CID | 4193737 |
| Molecular Formula | C26H29ClN4O |
| Molecular Weight | 449.00 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 1-[4-(5-benzyl-6-ethyl-2-methylpyrimidin-4-yl)piperazin-1-yl]-2-chloro-2-phenylethanone |
| SMILES | CCc1nc(C)nc(N2CCN(C(=O)C(Cl)c3ccccc3)CC2)c1Cc1ccccc1 |
| InChI | InChI=1S/C26H29ClN4O/c1-3-23-22(18-20-10-6-4-7-11-20)25(29-19(2)28-23)30-14-16-31(17-15-30)26(32)24(27)21-12-8-5-9-13-21/h4-13,24H,3,14-18H2,1-2H3 |
| InChIKey | ZMZUDNNKXMKJIO-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.00 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|