C21H26Cl2N4O — CID 1029555
2,2-dichloro-1-[4-[6-ethyl-2-methyl-5-[(4-methylphenyl)methyl]pyrimidin-4-yl]piperazin-1-yl]ethanone (PubChem CID 1029555) has the molecular formula C21H26Cl2N4O and a molecular weight of 421.37 g/mol. Its IUPAC name is 2,2-dichloro-1-[4-[6-ethyl-2-methyl-5-[(4-methylphenyl)methyl]pyrimidin-4-yl]piperazin-1-yl]ethanone.
| Compound Name | 2,2-dichloro-1-[4-[6-ethyl-2-methyl-5-[(4-methylphenyl)methyl]pyrimidin-4-yl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 1029555 |
| Molecular Formula | C21H26Cl2N4O |
| Molecular Weight | 421.37 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 2,2-dichloro-1-[4-[6-ethyl-2-methyl-5-[(4-methylphenyl)methyl]pyrimidin-4-yl]piperazin-1-yl]ethanone |
| SMILES | CCc1nc(C)nc(N2CCN(C(=O)C(Cl)Cl)CC2)c1Cc1ccc(C)cc1 |
| InChI | InChI=1S/C21H26Cl2N4O/c1-4-18-17(13-16-7-5-14(2)6-8-16)20(25-15(3)24-18)26-9-11-27(12-10-26)21(28)19(22)23/h5-8,19H,4,9-13H2,1-3H3 |
| InChIKey | RGYVQWZHXCQYRW-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.37 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|