C19H21N5O3 — CID 7493438
(2-methyl-4-pyrrolidin-1-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)-(3-nitrophenyl)methanone (PubChem CID 7493438) has the molecular formula C19H21N5O3 and a molecular weight of 367.41 g/mol. Its IUPAC name is (2-methyl-4-pyrrolidin-1-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)-(3-nitrophenyl)methanone.
| Compound Name | (2-methyl-4-pyrrolidin-1-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)-(3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 7493438 |
| Molecular Formula | C19H21N5O3 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | (2-methyl-4-pyrrolidin-1-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)-(3-nitrophenyl)methanone |
| SMILES | Cc1nc2c(c(N3CCCC3)n1)CN(C(=O)c1cccc([N+](=O)[O-])c1)CC2 |
| InChI | InChI=1S/C19H21N5O3/c1-13-20-17-7-10-23(12-16(17)18(21-13)22-8-2-3-9-22)19(25)14-5-4-6-15(11-14)24(26)27/h4-6,11H,2-3,7-10,12H2,1H3 |
| InChIKey | XCIFMCPFRQBDBW-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 92.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|