C26H27N5O3 — CID 42787798
[4-(4-methylpiperidin-1-yl)-2-phenyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]-(3-nitrophenyl)methanone (PubChem CID 42787798) has the molecular formula C26H27N5O3 and a molecular weight of 457.53 g/mol. Its IUPAC name is [4-(4-methylpiperidin-1-yl)-2-phenyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]-(3-nitrophenyl)methanone.
| Compound Name | [4-(4-methylpiperidin-1-yl)-2-phenyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]-(3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 42787798 |
| Molecular Formula | C26H27N5O3 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | [4-(4-methylpiperidin-1-yl)-2-phenyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]-(3-nitrophenyl)methanone |
| SMILES | CC1CCN(c2nc(-c3ccccc3)nc3c2CN(C(=O)c2cccc([N+](=O)[O-])c2)CC3)CC1 |
| InChI | InChI=1S/C26H27N5O3/c1-18-10-13-29(14-11-18)25-22-17-30(26(32)20-8-5-9-21(16-20)31(33)34)15-12-23(22)27-24(28-25)19-6-3-2-4-7-19/h2-9,16,18H,10-15,17H2,1H3 |
| InChIKey | WOZMQOFEMGPJHT-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 92.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|