C29H30N4O — CID 4095637
[4-(6-methyl-2-phenyl-5-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]-naphthalen-1-ylmethanone (PubChem CID 4095637) has the molecular formula C29H30N4O and a molecular weight of 450.59 g/mol. Its IUPAC name is [4-(6-methyl-2-phenyl-5-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]-naphthalen-1-ylmethanone.
| Compound Name | [4-(6-methyl-2-phenyl-5-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]-naphthalen-1-ylmethanone |
|---|---|
| PubChem CID | 4095637 |
| Molecular Formula | C29H30N4O |
| Molecular Weight | 450.59 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | [4-(6-methyl-2-phenyl-5-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]-naphthalen-1-ylmethanone |
| SMILES | Cc1nc(-c2ccccc2)nc(N2CCN(C(=O)c3cccc4ccccc34)CC2)c1C(C)C |
| InChI | InChI=1S/C29H30N4O/c1-20(2)26-21(3)30-27(23-11-5-4-6-12-23)31-28(26)32-16-18-33(19-17-32)29(34)25-15-9-13-22-10-7-8-14-24(22)25/h4-15,20H,16-19H2,1-3H3 |
| InChIKey | YFKNVZQVSYEDCZ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.59 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |