C18H21Cl2N5O3 — CID 19536375
1-[4-[(2,6-dichlorophenyl)methyl]piperazin-1-yl]-2-(3-methyl-4-nitropyrazol-1-yl)propan-1-one (PubChem CID 19536375) has the molecular formula C18H21Cl2N5O3 and a molecular weight of 426.30 g/mol. Its IUPAC name is 1-[4-[(2,6-dichlorophenyl)methyl]piperazin-1-yl]-2-(3-methyl-4-nitropyrazol-1-yl)propan-1-one.
| Compound Name | 1-[4-[(2,6-dichlorophenyl)methyl]piperazin-1-yl]-2-(3-methyl-4-nitropyrazol-1-yl)propan-1-one |
|---|---|
| PubChem CID | 19536375 |
| Molecular Formula | C18H21Cl2N5O3 |
| Molecular Weight | 426.30 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | 1-[4-[(2,6-dichlorophenyl)methyl]piperazin-1-yl]-2-(3-methyl-4-nitropyrazol-1-yl)propan-1-one |
| SMILES | Cc1nn(C(C)C(=O)N2CCN(Cc3c(Cl)cccc3Cl)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H21Cl2N5O3/c1-12-17(25(27)28)11-24(21-12)13(2)18(26)23-8-6-22(7-9-23)10-14-15(19)4-3-5-16(14)20/h3-5,11,13H,6-10H2,1-2H3 |
| InChIKey | DJKCTFCDGRYHJY-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 84.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.30 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|