C16H15ClFN7O3 — CID 19533212
N-[1-[(2-chloro-6-fluorophenyl)methyl]-1,2,4-triazol-3-yl]-2-(3-methyl-4-nitropyrazol-1-yl)propanamide (PubChem CID 19533212) has the molecular formula C16H15ClFN7O3 and a molecular weight of 407.79 g/mol. Its IUPAC name is N-[1-[(2-chloro-6-fluorophenyl)methyl]-1,2,4-triazol-3-yl]-2-(3-methyl-4-nitropyrazol-1-yl)propanamide.
| Compound Name | N-[1-[(2-chloro-6-fluorophenyl)methyl]-1,2,4-triazol-3-yl]-2-(3-methyl-4-nitropyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 19533212 |
| Molecular Formula | C16H15ClFN7O3 |
| Molecular Weight | 407.79 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | N-[1-[(2-chloro-6-fluorophenyl)methyl]-1,2,4-triazol-3-yl]-2-(3-methyl-4-nitropyrazol-1-yl)propanamide |
| SMILES | Cc1nn(C(C)C(=O)Nc2ncn(Cc3c(F)cccc3Cl)n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H15ClFN7O3/c1-9-14(25(27)28)7-24(21-9)10(2)15(26)20-16-19-8-23(22-16)6-11-12(17)4-3-5-13(11)18/h3-5,7-8,10H,6H2,1-2H3,(H,20,22,26) |
| InChIKey | YAJKHUKQSGFEJW-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.79 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|