C15H12ClFN8O5 — CID 19530040
N-[1-[(2-chloro-6-fluorophenyl)methyl]-1,2,4-triazol-3-yl]-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide (PubChem CID 19530040) has the molecular formula C15H12ClFN8O5 and a molecular weight of 438.76 g/mol. Its IUPAC name is N-[1-[(2-chloro-6-fluorophenyl)methyl]-1,2,4-triazol-3-yl]-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide.
| Compound Name | N-[1-[(2-chloro-6-fluorophenyl)methyl]-1,2,4-triazol-3-yl]-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 19530040 |
| Molecular Formula | C15H12ClFN8O5 |
| Molecular Weight | 438.76 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | N-[1-[(2-chloro-6-fluorophenyl)methyl]-1,2,4-triazol-3-yl]-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide |
| SMILES | Cc1c([N+](=O)[O-])c([N+](=O)[O-])nn1CC(=O)Nc1ncn(Cc2c(F)cccc2Cl)n1 |
| InChI | InChI=1S/C15H12ClFN8O5/c1-8-13(24(27)28)14(25(29)30)20-23(8)6-12(26)19-15-18-7-22(21-15)5-9-10(16)3-2-4-11(9)17/h2-4,7H,5-6H2,1H3,(H,19,21,26) |
| InChIKey | DNVGWEUTNPAFOG-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 163.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.76 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|