C17H12Cl2F4N6O3 — CID 19524350
N-[4-chloro-1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-2-[5-methyl-4-nitro-3-(trifluoromethyl)pyrazol-1-yl]acetamide (PubChem CID 19524350) has the molecular formula C17H12Cl2F4N6O3 and a molecular weight of 495.22 g/mol. Its IUPAC name is N-[4-chloro-1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-2-[5-methyl-4-nitro-3-(trifluoromethyl)pyrazol-1-yl]acetamide.
| Compound Name | N-[4-chloro-1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-2-[5-methyl-4-nitro-3-(trifluoromethyl)pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 19524350 |
| Molecular Formula | C17H12Cl2F4N6O3 |
| Molecular Weight | 495.22 g/mol |
| Exact Mass | 494.03 |
| IUPAC Name | N-[4-chloro-1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-2-[5-methyl-4-nitro-3-(trifluoromethyl)pyrazol-1-yl]acetamide |
| SMILES | Cc1c([N+](=O)[O-])c(C(F)(F)F)nn1CC(=O)Nc1nn(Cc2c(F)cccc2Cl)cc1Cl |
| InChI | InChI=1S/C17H12Cl2F4N6O3/c1-8-14(29(31)32)15(17(21,22)23)25-28(8)7-13(30)24-16-11(19)6-27(26-16)5-9-10(18)3-2-4-12(9)20/h2-4,6H,5,7H2,1H3,(H,24,26,30) |
| InChIKey | ITMSTABUUDFVAJ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.22 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|