C13H7F7N4O3 — CID 19524185
2-[5-methyl-4-nitro-3-(trifluoromethyl)pyrazol-1-yl]-N-(2,3,5,6-tetrafluorophenyl)acetamide (PubChem CID 19524185) has the molecular formula C13H7F7N4O3 and a molecular weight of 400.21 g/mol. Its IUPAC name is 2-[5-methyl-4-nitro-3-(trifluoromethyl)pyrazol-1-yl]-N-(2,3,5,6-tetrafluorophenyl)acetamide.
| Compound Name | 2-[5-methyl-4-nitro-3-(trifluoromethyl)pyrazol-1-yl]-N-(2,3,5,6-tetrafluorophenyl)acetamide |
|---|---|
| PubChem CID | 19524185 |
| Molecular Formula | C13H7F7N4O3 |
| Molecular Weight | 400.21 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | 2-[5-methyl-4-nitro-3-(trifluoromethyl)pyrazol-1-yl]-N-(2,3,5,6-tetrafluorophenyl)acetamide |
| SMILES | Cc1c([N+](=O)[O-])c(C(F)(F)F)nn1CC(=O)Nc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C13H7F7N4O3/c1-4-11(24(26)27)12(13(18,19)20)22-23(4)3-7(25)21-10-8(16)5(14)2-6(15)9(10)17/h2H,3H2,1H3,(H,21,25) |
| InChIKey | HMMHLFGQJXMXFU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.21 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|