C20H16F3N5O7 — CID 19524316
N-[3-(4-methoxyphenoxy)-5-nitrophenyl]-2-[5-methyl-4-nitro-3-(trifluoromethyl)pyrazol-1-yl]acetamide (PubChem CID 19524316) has the molecular formula C20H16F3N5O7 and a molecular weight of 495.37 g/mol. Its IUPAC name is N-[3-(4-methoxyphenoxy)-5-nitrophenyl]-2-[5-methyl-4-nitro-3-(trifluoromethyl)pyrazol-1-yl]acetamide.
| Compound Name | N-[3-(4-methoxyphenoxy)-5-nitrophenyl]-2-[5-methyl-4-nitro-3-(trifluoromethyl)pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 19524316 |
| Molecular Formula | C20H16F3N5O7 |
| Molecular Weight | 495.37 g/mol |
| Exact Mass | 495.10 |
| IUPAC Name | N-[3-(4-methoxyphenoxy)-5-nitrophenyl]-2-[5-methyl-4-nitro-3-(trifluoromethyl)pyrazol-1-yl]acetamide |
| SMILES | COc1ccc(Oc2cc(NC(=O)Cn3nc(C(F)(F)F)c([N+](=O)[O-])c3C)cc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C20H16F3N5O7/c1-11-18(28(32)33)19(20(21,22)23)25-26(11)10-17(29)24-12-7-13(27(30)31)9-16(8-12)35-15-5-3-14(34-2)4-6-15/h3-9H,10H2,1-2H3,(H,24,29) |
| InChIKey | DMVLPCLQWSFWHH-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 151.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.37 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|