C24H23F3N4O5 — CID 19523706
N-[3-(4-methoxyphenoxy)-5-nitrophenyl]-2-[3-(trifluoromethyl)-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazol-1-yl]acetamide (PubChem CID 19523706) has the molecular formula C24H23F3N4O5 and a molecular weight of 504.47 g/mol. Its IUPAC name is N-[3-(4-methoxyphenoxy)-5-nitrophenyl]-2-[3-(trifluoromethyl)-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazol-1-yl]acetamide.
| Compound Name | N-[3-(4-methoxyphenoxy)-5-nitrophenyl]-2-[3-(trifluoromethyl)-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 19523706 |
| Molecular Formula | C24H23F3N4O5 |
| Molecular Weight | 504.47 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | N-[3-(4-methoxyphenoxy)-5-nitrophenyl]-2-[3-(trifluoromethyl)-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazol-1-yl]acetamide |
| SMILES | COc1ccc(Oc2cc(NC(=O)Cn3nc(C(F)(F)F)c4c3CCCCC4)cc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C24H23F3N4O5/c1-35-17-7-9-18(10-8-17)36-19-12-15(11-16(13-19)31(33)34)28-22(32)14-30-21-6-4-2-3-5-20(21)23(29-30)24(25,26)27/h7-13H,2-6,14H2,1H3,(H,28,32) |
| InChIKey | JIDSLRCSUUGFQL-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.47 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|