C18H13F3N6O6 — CID 19524448
2-[5-methyl-4-nitro-3-(trifluoromethyl)pyrazol-1-yl]-N-(3-nitro-5-pyridin-3-yloxyphenyl)acetamide (PubChem CID 19524448) has the molecular formula C18H13F3N6O6 and a molecular weight of 466.33 g/mol. Its IUPAC name is 2-[5-methyl-4-nitro-3-(trifluoromethyl)pyrazol-1-yl]-N-(3-nitro-5-pyridin-3-yloxyphenyl)acetamide.
| Compound Name | 2-[5-methyl-4-nitro-3-(trifluoromethyl)pyrazol-1-yl]-N-(3-nitro-5-pyridin-3-yloxyphenyl)acetamide |
|---|---|
| PubChem CID | 19524448 |
| Molecular Formula | C18H13F3N6O6 |
| Molecular Weight | 466.33 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | 2-[5-methyl-4-nitro-3-(trifluoromethyl)pyrazol-1-yl]-N-(3-nitro-5-pyridin-3-yloxyphenyl)acetamide |
| SMILES | Cc1c([N+](=O)[O-])c(C(F)(F)F)nn1CC(=O)Nc1cc(Oc2cccnc2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H13F3N6O6/c1-10-16(27(31)32)17(18(19,20)21)24-25(10)9-15(28)23-11-5-12(26(29)30)7-14(6-11)33-13-3-2-4-22-8-13/h2-8H,9H2,1H3,(H,23,28) |
| InChIKey | PDXKWXKCHDIGJD-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 155.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.33 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|