C17H11BrF3N5O4 — CID 19481151
4-bromo-1-methyl-N-(3-nitro-5-pyridin-3-yloxyphenyl)-3-(trifluoromethyl)pyrazole-5-carboxamide (PubChem CID 19481151) has the molecular formula C17H11BrF3N5O4 and a molecular weight of 486.20 g/mol. Its IUPAC name is 4-bromo-1-methyl-N-(3-nitro-5-pyridin-3-yloxyphenyl)-3-(trifluoromethyl)pyrazole-5-carboxamide.
| Compound Name | 4-bromo-1-methyl-N-(3-nitro-5-pyridin-3-yloxyphenyl)-3-(trifluoromethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19481151 |
| Molecular Formula | C17H11BrF3N5O4 |
| Molecular Weight | 486.20 g/mol |
| Exact Mass | 484.99 |
| IUPAC Name | 4-bromo-1-methyl-N-(3-nitro-5-pyridin-3-yloxyphenyl)-3-(trifluoromethyl)pyrazole-5-carboxamide |
| SMILES | Cn1nc(C(F)(F)F)c(Br)c1C(=O)Nc1cc(Oc2cccnc2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H11BrF3N5O4/c1-25-14(13(18)15(24-25)17(19,20)21)16(27)23-9-5-10(26(28)29)7-12(6-9)30-11-3-2-4-22-8-11/h2-8H,1H3,(H,23,27) |
| InChIKey | BZNSMKIPYBZDPC-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.20 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|