C19H14BrF3N4O5 — CID 19481124
4-bromo-N-[3-(2-methoxyphenoxy)-5-nitrophenyl]-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide (PubChem CID 19481124) has the molecular formula C19H14BrF3N4O5 and a molecular weight of 515.24 g/mol. Its IUPAC name is 4-bromo-N-[3-(2-methoxyphenoxy)-5-nitrophenyl]-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide.
| Compound Name | 4-bromo-N-[3-(2-methoxyphenoxy)-5-nitrophenyl]-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19481124 |
| Molecular Formula | C19H14BrF3N4O5 |
| Molecular Weight | 515.24 g/mol |
| Exact Mass | 514.01 |
| IUPAC Name | 4-bromo-N-[3-(2-methoxyphenoxy)-5-nitrophenyl]-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide |
| SMILES | COc1ccccc1Oc1cc(NC(=O)c2c(Br)c(C(F)(F)F)nn2C)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H14BrF3N4O5/c1-26-16(15(20)17(25-26)19(21,22)23)18(28)24-10-7-11(27(29)30)9-12(8-10)32-14-6-4-3-5-13(14)31-2/h3-9H,1-2H3,(H,24,28) |
| InChIKey | URFLRPXZDYWIKY-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.24 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|