C19H13Cl2F3N4O4 — CID 19481737
4-chloro-N-[3-(4-chloro-2-methylphenoxy)-5-nitrophenyl]-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide (PubChem CID 19481737) has the molecular formula C19H13Cl2F3N4O4 and a molecular weight of 489.24 g/mol. Its IUPAC name is 4-chloro-N-[3-(4-chloro-2-methylphenoxy)-5-nitrophenyl]-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide.
| Compound Name | 4-chloro-N-[3-(4-chloro-2-methylphenoxy)-5-nitrophenyl]-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19481737 |
| Molecular Formula | C19H13Cl2F3N4O4 |
| Molecular Weight | 489.24 g/mol |
| Exact Mass | 488.03 |
| IUPAC Name | 4-chloro-N-[3-(4-chloro-2-methylphenoxy)-5-nitrophenyl]-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide |
| SMILES | Cc1cc(Cl)ccc1Oc1cc(NC(=O)c2c(Cl)c(C(F)(F)F)nn2C)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H13Cl2F3N4O4/c1-9-5-10(20)3-4-14(9)32-13-7-11(6-12(8-13)28(30)31)25-18(29)16-15(21)17(19(22,23)24)26-27(16)2/h3-8H,1-2H3,(H,25,29) |
| InChIKey | AOSUGJWOSLPNGO-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.24 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|