C22H20ClF3N4O4 — CID 19566599
N-[3-(4-chloro-2-methylphenoxy)-5-nitrophenyl]-2-methyl-3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propanamide (PubChem CID 19566599) has the molecular formula C22H20ClF3N4O4 and a molecular weight of 496.87 g/mol. Its IUPAC name is N-[3-(4-chloro-2-methylphenoxy)-5-nitrophenyl]-2-methyl-3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propanamide.
| Compound Name | N-[3-(4-chloro-2-methylphenoxy)-5-nitrophenyl]-2-methyl-3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propanamide |
|---|---|
| PubChem CID | 19566599 |
| Molecular Formula | C22H20ClF3N4O4 |
| Molecular Weight | 496.87 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | N-[3-(4-chloro-2-methylphenoxy)-5-nitrophenyl]-2-methyl-3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propanamide |
| SMILES | Cc1cc(Cl)ccc1Oc1cc(NC(=O)C(C)Cn2nc(C(F)(F)F)cc2C)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H20ClF3N4O4/c1-12-6-15(23)4-5-19(12)34-18-9-16(8-17(10-18)30(32)33)27-21(31)13(2)11-29-14(3)7-20(28-29)22(24,25)26/h4-10,13H,11H2,1-3H3,(H,27,31) |
| InChIKey | XAYHEMUDUBWLPF-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.87 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|