C23H20ClF3N4O4 — CID 19564043
N-[3-(4-chloro-2-methylphenoxy)-5-nitrophenyl]-3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propanamide (PubChem CID 19564043) has the molecular formula C23H20ClF3N4O4 and a molecular weight of 508.88 g/mol. Its IUPAC name is N-[3-(4-chloro-2-methylphenoxy)-5-nitrophenyl]-3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propanamide.
| Compound Name | N-[3-(4-chloro-2-methylphenoxy)-5-nitrophenyl]-3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propanamide |
|---|---|
| PubChem CID | 19564043 |
| Molecular Formula | C23H20ClF3N4O4 |
| Molecular Weight | 508.88 g/mol |
| Exact Mass | 508.11 |
| IUPAC Name | N-[3-(4-chloro-2-methylphenoxy)-5-nitrophenyl]-3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propanamide |
| SMILES | Cc1cc(Cl)ccc1Oc1cc(NC(=O)CCn2nc(C(F)(F)F)cc2C2CC2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H20ClF3N4O4/c1-13-8-15(24)4-5-20(13)35-18-10-16(9-17(11-18)31(33)34)28-22(32)6-7-30-19(14-2-3-14)12-21(29-30)23(25,26)27/h4-5,8-12,14H,2-3,6-7H2,1H3,(H,28,32) |
| InChIKey | ZYXSFBBALHNUTE-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.88 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|