C23H19Cl2F3N4O4 — CID 19570725
3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]-N-[3-(2,4-dichlorophenoxy)-5-nitrophenyl]-2-methylpropanamide (PubChem CID 19570725) has the molecular formula C23H19Cl2F3N4O4 and a molecular weight of 543.33 g/mol. Its IUPAC name is 3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]-N-[3-(2,4-dichlorophenoxy)-5-nitrophenyl]-2-methylpropanamide.
| Compound Name | 3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]-N-[3-(2,4-dichlorophenoxy)-5-nitrophenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 19570725 |
| Molecular Formula | C23H19Cl2F3N4O4 |
| Molecular Weight | 543.33 g/mol |
| Exact Mass | 542.07 |
| IUPAC Name | 3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]-N-[3-(2,4-dichlorophenoxy)-5-nitrophenyl]-2-methylpropanamide |
| SMILES | CC(Cn1nc(C(F)(F)F)cc1C1CC1)C(=O)Nc1cc(Oc2ccc(Cl)cc2Cl)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H19Cl2F3N4O4/c1-12(11-31-19(13-2-3-13)10-21(30-31)23(26,27)28)22(33)29-15-7-16(32(34)35)9-17(8-15)36-20-5-4-14(24)6-18(20)25/h4-10,12-13H,2-3,11H2,1H3,(H,29,33) |
| InChIKey | PYVABLJHXOYKGX-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.33 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|