C18H16BrN5O4 — CID 19525665
2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-(3-nitro-5-pyridin-3-yloxyphenyl)acetamide (PubChem CID 19525665) has the molecular formula C18H16BrN5O4 and a molecular weight of 446.26 g/mol. Its IUPAC name is 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-(3-nitro-5-pyridin-3-yloxyphenyl)acetamide.
| Compound Name | 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-(3-nitro-5-pyridin-3-yloxyphenyl)acetamide |
|---|---|
| PubChem CID | 19525665 |
| Molecular Formula | C18H16BrN5O4 |
| Molecular Weight | 446.26 g/mol |
| Exact Mass | 445.04 |
| IUPAC Name | 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-(3-nitro-5-pyridin-3-yloxyphenyl)acetamide |
| SMILES | Cc1nn(CC(=O)Nc2cc(Oc3cccnc3)cc([N+](=O)[O-])c2)c(C)c1Br |
| InChI | InChI=1S/C18H16BrN5O4/c1-11-18(19)12(2)23(22-11)10-17(25)21-13-6-14(24(26)27)8-16(7-13)28-15-4-3-5-20-9-15/h3-9H,10H2,1-2H3,(H,21,25) |
| InChIKey | RYPPVVZTNOVNDN-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.26 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|