C20H17F2N5O4 — CID 19520484
2-[5-cyclopropyl-3-(difluoromethyl)pyrazol-1-yl]-N-(3-nitro-5-pyridin-3-yloxyphenyl)acetamide (PubChem CID 19520484) has the molecular formula C20H17F2N5O4 and a molecular weight of 429.38 g/mol. Its IUPAC name is 2-[5-cyclopropyl-3-(difluoromethyl)pyrazol-1-yl]-N-(3-nitro-5-pyridin-3-yloxyphenyl)acetamide.
| Compound Name | 2-[5-cyclopropyl-3-(difluoromethyl)pyrazol-1-yl]-N-(3-nitro-5-pyridin-3-yloxyphenyl)acetamide |
|---|---|
| PubChem CID | 19520484 |
| Molecular Formula | C20H17F2N5O4 |
| Molecular Weight | 429.38 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | 2-[5-cyclopropyl-3-(difluoromethyl)pyrazol-1-yl]-N-(3-nitro-5-pyridin-3-yloxyphenyl)acetamide |
| SMILES | O=C(Cn1nc(C(F)F)cc1C1CC1)Nc1cc(Oc2cccnc2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H17F2N5O4/c21-20(22)17-9-18(12-3-4-12)26(25-17)11-19(28)24-13-6-14(27(29)30)8-16(7-13)31-15-2-1-5-23-10-15/h1-2,5-10,12,20H,3-4,11H2,(H,24,28) |
| InChIKey | PQYYOTZVBLELMT-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.38 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|