C15H12F6N4O4 — CID 19518115
2-[3,5-bis(difluoromethyl)pyrazol-1-yl]-N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]acetamide (PubChem CID 19518115) has the molecular formula C15H12F6N4O4 and a molecular weight of 426.27 g/mol. Its IUPAC name is 2-[3,5-bis(difluoromethyl)pyrazol-1-yl]-N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]acetamide.
| Compound Name | 2-[3,5-bis(difluoromethyl)pyrazol-1-yl]-N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]acetamide |
|---|---|
| PubChem CID | 19518115 |
| Molecular Formula | C15H12F6N4O4 |
| Molecular Weight | 426.27 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | 2-[3,5-bis(difluoromethyl)pyrazol-1-yl]-N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]acetamide |
| SMILES | O=C(Cn1nc(C(F)F)cc1C(F)F)Nc1cc(OCC(F)F)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H12F6N4O4/c16-12(17)6-29-9-2-7(1-8(3-9)25(27)28)22-13(26)5-24-11(15(20)21)4-10(23-24)14(18)19/h1-4,12,14-15H,5-6H2,(H,22,26) |
| InChIKey | MUKQMTSVWKIKTJ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.27 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|