C16H16F4N4O4 — CID 19539444
N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]-2-[3-(difluoromethyl)-5-methylpyrazol-1-yl]propanamide (PubChem CID 19539444) has the molecular formula C16H16F4N4O4 and a molecular weight of 404.32 g/mol. Its IUPAC name is N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]-2-[3-(difluoromethyl)-5-methylpyrazol-1-yl]propanamide.
| Compound Name | N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]-2-[3-(difluoromethyl)-5-methylpyrazol-1-yl]propanamide |
|---|---|
| PubChem CID | 19539444 |
| Molecular Formula | C16H16F4N4O4 |
| Molecular Weight | 404.32 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]-2-[3-(difluoromethyl)-5-methylpyrazol-1-yl]propanamide |
| SMILES | Cc1cc(C(F)F)nn1C(C)C(=O)Nc1cc(OCC(F)F)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H16F4N4O4/c1-8-3-13(15(19)20)22-23(8)9(2)16(25)21-10-4-11(24(26)27)6-12(5-10)28-7-14(17)18/h3-6,9,14-15H,7H2,1-2H3,(H,21,25) |
| InChIKey | KEXDFDQQANBRDC-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.32 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|