C14H12F2N6O8 — CID 19529964
N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide (PubChem CID 19529964) has the molecular formula C14H12F2N6O8 and a molecular weight of 430.28 g/mol. Its IUPAC name is N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide.
| Compound Name | N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 19529964 |
| Molecular Formula | C14H12F2N6O8 |
| Molecular Weight | 430.28 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide |
| SMILES | Cc1c([N+](=O)[O-])c([N+](=O)[O-])nn1CC(=O)Nc1cc(OCC(F)F)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H12F2N6O8/c1-7-13(21(26)27)14(22(28)29)18-19(7)5-12(23)17-8-2-9(20(24)25)4-10(3-8)30-6-11(15)16/h2-4,11H,5-6H2,1H3,(H,17,23) |
| InChIKey | PFXKFNGKKUEFLD-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 185.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|