C15H15ClF2N4O4 — CID 19533726
2-(4-chloro-5-methylpyrazol-1-yl)-N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]propanamide (PubChem CID 19533726) has the molecular formula C15H15ClF2N4O4 and a molecular weight of 388.76 g/mol. Its IUPAC name is 2-(4-chloro-5-methylpyrazol-1-yl)-N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]propanamide.
| Compound Name | 2-(4-chloro-5-methylpyrazol-1-yl)-N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]propanamide |
|---|---|
| PubChem CID | 19533726 |
| Molecular Formula | C15H15ClF2N4O4 |
| Molecular Weight | 388.76 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | 2-(4-chloro-5-methylpyrazol-1-yl)-N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]propanamide |
| SMILES | Cc1c(Cl)cnn1C(C)C(=O)Nc1cc(OCC(F)F)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H15ClF2N4O4/c1-8-13(16)6-19-21(8)9(2)15(23)20-10-3-11(22(24)25)5-12(4-10)26-7-14(17)18/h3-6,9,14H,7H2,1-2H3,(H,20,23) |
| InChIKey | XJRULPKTUHDILU-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.76 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|