C15H14F2N4O6 — CID 19505028
1-[1-[3-(2,2-difluoroethoxy)-5-nitroanilino]-1-oxopropan-2-yl]pyrazole-4-carboxylic acid (PubChem CID 19505028) has the molecular formula C15H14F2N4O6 and a molecular weight of 384.30 g/mol. Its IUPAC name is 1-[1-[3-(2,2-difluoroethoxy)-5-nitroanilino]-1-oxopropan-2-yl]pyrazole-4-carboxylic acid.
| Compound Name | 1-[1-[3-(2,2-difluoroethoxy)-5-nitroanilino]-1-oxopropan-2-yl]pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 19505028 |
| Molecular Formula | C15H14F2N4O6 |
| Molecular Weight | 384.30 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 1-[1-[3-(2,2-difluoroethoxy)-5-nitroanilino]-1-oxopropan-2-yl]pyrazole-4-carboxylic acid |
| SMILES | CC(C(=O)Nc1cc(OCC(F)F)cc([N+](=O)[O-])c1)n1cc(C(=O)O)cn1 |
| InChI | InChI=1S/C15H14F2N4O6/c1-8(20-6-9(5-18-20)15(23)24)14(22)19-10-2-11(21(25)26)4-12(3-10)27-7-13(16)17/h2-6,8,13H,7H2,1H3,(H,19,22)(H,23,24) |
| InChIKey | AQKBMUYZEWGQNP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 136.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.30 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|