C13H11F2N5O6 — CID 19515992
N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]-2-(4-nitropyrazol-1-yl)acetamide (PubChem CID 19515992) has the molecular formula C13H11F2N5O6 and a molecular weight of 371.26 g/mol. Its IUPAC name is N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]-2-(4-nitropyrazol-1-yl)acetamide.
| Compound Name | N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]-2-(4-nitropyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 19515992 |
| Molecular Formula | C13H11F2N5O6 |
| Molecular Weight | 371.26 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]-2-(4-nitropyrazol-1-yl)acetamide |
| SMILES | O=C(Cn1cc([N+](=O)[O-])cn1)Nc1cc(OCC(F)F)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H11F2N5O6/c14-12(15)7-26-11-2-8(1-9(3-11)19(22)23)17-13(21)6-18-5-10(4-16-18)20(24)25/h1-5,12H,6-7H2,(H,17,21) |
| InChIKey | HEJFVTZIIQWILY-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 142.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.26 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|