C15H13ClF4N4O4 — CID 19517517
2-[4-chloro-3-(difluoromethyl)-5-methylpyrazol-1-yl]-N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]acetamide (PubChem CID 19517517) has the molecular formula C15H13ClF4N4O4 and a molecular weight of 424.74 g/mol. Its IUPAC name is 2-[4-chloro-3-(difluoromethyl)-5-methylpyrazol-1-yl]-N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]acetamide.
| Compound Name | 2-[4-chloro-3-(difluoromethyl)-5-methylpyrazol-1-yl]-N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]acetamide |
|---|---|
| PubChem CID | 19517517 |
| Molecular Formula | C15H13ClF4N4O4 |
| Molecular Weight | 424.74 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | 2-[4-chloro-3-(difluoromethyl)-5-methylpyrazol-1-yl]-N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]acetamide |
| SMILES | Cc1c(Cl)c(C(F)F)nn1CC(=O)Nc1cc(OCC(F)F)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H13ClF4N4O4/c1-7-13(16)14(15(19)20)22-23(7)5-12(25)21-8-2-9(24(26)27)4-10(3-8)28-6-11(17)18/h2-4,11,15H,5-6H2,1H3,(H,21,25) |
| InChIKey | OXFLGHKIPIWXRQ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.74 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|