C13H11F2IN4O4 — CID 19476141
N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]-4-iodo-1-methylpyrazole-5-carboxamide (PubChem CID 19476141) has the molecular formula C13H11F2IN4O4 and a molecular weight of 452.16 g/mol. Its IUPAC name is N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]-4-iodo-1-methylpyrazole-5-carboxamide.
| Compound Name | N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]-4-iodo-1-methylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19476141 |
| Molecular Formula | C13H11F2IN4O4 |
| Molecular Weight | 452.16 g/mol |
| Exact Mass | 451.98 |
| IUPAC Name | N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]-4-iodo-1-methylpyrazole-5-carboxamide |
| SMILES | Cn1ncc(I)c1C(=O)Nc1cc(OCC(F)F)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H11F2IN4O4/c1-19-12(10(16)5-17-19)13(21)18-7-2-8(20(22)23)4-9(3-7)24-6-11(14)15/h2-5,11H,6H2,1H3,(H,18,21) |
| InChIKey | BBFVQAAWSVLHJG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.16 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|