C16H12F2N4O5 — CID 19513942
N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]-5-(furan-2-yl)-1H-pyrazole-3-carboxamide (PubChem CID 19513942) has the molecular formula C16H12F2N4O5 and a molecular weight of 378.29 g/mol. Its IUPAC name is N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]-5-(furan-2-yl)-1H-pyrazole-3-carboxamide.
| Compound Name | N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]-5-(furan-2-yl)-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19513942 |
| Molecular Formula | C16H12F2N4O5 |
| Molecular Weight | 378.29 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]-5-(furan-2-yl)-1H-pyrazole-3-carboxamide |
| SMILES | O=C(Nc1cc(OCC(F)F)cc([N+](=O)[O-])c1)c1cc(-c2ccco2)[nH]n1 |
| InChI | InChI=1S/C16H12F2N4O5/c17-15(18)8-27-11-5-9(4-10(6-11)22(24)25)19-16(23)13-7-12(20-21-13)14-2-1-3-26-14/h1-7,15H,8H2,(H,19,23)(H,20,21) |
| InChIKey | CSCTZGJEHBUARN-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 123.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.29 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|