C16H13F2N3O4 — CID 19514034
N-[4-(difluoromethoxy)-3-methoxyphenyl]-5-(furan-2-yl)-1H-pyrazole-3-carboxamide (PubChem CID 19514034) has the molecular formula C16H13F2N3O4 and a molecular weight of 349.29 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)-3-methoxyphenyl]-5-(furan-2-yl)-1H-pyrazole-3-carboxamide.
| Compound Name | N-[4-(difluoromethoxy)-3-methoxyphenyl]-5-(furan-2-yl)-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19514034 |
| Molecular Formula | C16H13F2N3O4 |
| Molecular Weight | 349.29 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | N-[4-(difluoromethoxy)-3-methoxyphenyl]-5-(furan-2-yl)-1H-pyrazole-3-carboxamide |
| SMILES | COc1cc(NC(=O)c2cc(-c3ccco3)[nH]n2)ccc1OC(F)F |
| InChI | InChI=1S/C16H13F2N3O4/c1-23-14-7-9(4-5-13(14)25-16(17)18)19-15(22)11-8-10(20-21-11)12-3-2-6-24-12/h2-8,16H,1H3,(H,19,22)(H,20,21) |
| InChIKey | YSVROWRYBXCKRY-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.29 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |