C13H12ClF2N3O3 — CID 19475965
4-chloro-N-[4-(difluoromethoxy)-3-methoxyphenyl]-1-methylpyrazole-5-carboxamide (PubChem CID 19475965) has the molecular formula C13H12ClF2N3O3 and a molecular weight of 331.71 g/mol. Its IUPAC name is 4-chloro-N-[4-(difluoromethoxy)-3-methoxyphenyl]-1-methylpyrazole-5-carboxamide.
| Compound Name | 4-chloro-N-[4-(difluoromethoxy)-3-methoxyphenyl]-1-methylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19475965 |
| Molecular Formula | C13H12ClF2N3O3 |
| Molecular Weight | 331.71 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | 4-chloro-N-[4-(difluoromethoxy)-3-methoxyphenyl]-1-methylpyrazole-5-carboxamide |
| SMILES | COc1cc(NC(=O)c2c(Cl)cnn2C)ccc1OC(F)F |
| InChI | InChI=1S/C13H12ClF2N3O3/c1-19-11(8(14)6-17-19)12(20)18-7-3-4-9(22-13(15)16)10(5-7)21-2/h3-6,13H,1-2H3,(H,18,20) |
| InChIKey | IJVRLYQDSPTCKY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.71 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |