C14H15ClN4O3 — CID 131940972
4-chloro-N-[4-[(2-methoxyacetyl)amino]phenyl]-1-methylpyrazole-5-carboxamide (PubChem CID 131940972) has the molecular formula C14H15ClN4O3 and a molecular weight of 322.75 g/mol. Its IUPAC name is 4-chloro-N-[4-[(2-methoxyacetyl)amino]phenyl]-1-methylpyrazole-5-carboxamide.
| Compound Name | 4-chloro-N-[4-[(2-methoxyacetyl)amino]phenyl]-1-methylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 131940972 |
| Molecular Formula | C14H15ClN4O3 |
| Molecular Weight | 322.75 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 4-chloro-N-[4-[(2-methoxyacetyl)amino]phenyl]-1-methylpyrazole-5-carboxamide |
| SMILES | COCC(=O)Nc1ccc(NC(=O)c2c(Cl)cnn2C)cc1 |
| InChI | InChI=1S/C14H15ClN4O3/c1-19-13(11(15)7-16-19)14(21)18-10-5-3-9(4-6-10)17-12(20)8-22-2/h3-7H,8H2,1-2H3,(H,17,20)(H,18,21) |
| InChIKey | OKFKGIXBJZDMED-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.75 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |