C14H14Cl2N4O2 — CID 50981583
4-chloro-N-[3-chloro-4-(propanoylamino)phenyl]-1-methylpyrazole-5-carboxamide (PubChem CID 50981583) has the molecular formula C14H14Cl2N4O2 and a molecular weight of 341.20 g/mol. Its IUPAC name is 4-chloro-N-[3-chloro-4-(propanoylamino)phenyl]-1-methylpyrazole-5-carboxamide.
| Compound Name | 4-chloro-N-[3-chloro-4-(propanoylamino)phenyl]-1-methylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 50981583 |
| Molecular Formula | C14H14Cl2N4O2 |
| Molecular Weight | 341.20 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | 4-chloro-N-[3-chloro-4-(propanoylamino)phenyl]-1-methylpyrazole-5-carboxamide |
| SMILES | CCC(=O)Nc1ccc(NC(=O)c2c(Cl)cnn2C)cc1Cl |
| InChI | InChI=1S/C14H14Cl2N4O2/c1-3-12(21)19-11-5-4-8(6-9(11)15)18-14(22)13-10(16)7-17-20(13)2/h4-7H,3H2,1-2H3,(H,18,22)(H,19,21) |
| InChIKey | VSARYNGONTWKJG-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.20 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |