C13H14ClN5O2 — CID 65355536
N-(4-acetamido-3-chlorophenyl)-4-amino-1-methylpyrazole-5-carboxamide (PubChem CID 65355536) has the molecular formula C13H14ClN5O2 and a molecular weight of 307.74 g/mol. Its IUPAC name is N-(4-acetamido-3-chlorophenyl)-4-amino-1-methylpyrazole-5-carboxamide.
| Compound Name | N-(4-acetamido-3-chlorophenyl)-4-amino-1-methylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 65355536 |
| Molecular Formula | C13H14ClN5O2 |
| Molecular Weight | 307.74 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | N-(4-acetamido-3-chlorophenyl)-4-amino-1-methylpyrazole-5-carboxamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)c2c(N)cnn2C)cc1Cl |
| InChI | InChI=1S/C13H14ClN5O2/c1-7(20)17-11-4-3-8(5-9(11)14)18-13(21)12-10(15)6-16-19(12)2/h3-6H,15H2,1-2H3,(H,17,20)(H,18,21) |
| InChIKey | RTEZAPCRBZHSNO-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.74 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |