C6H8ClN3O — CID 17144538
4-chloro-N,1-dimethylpyrazole-5-carboxamide (PubChem CID 17144538) has the molecular formula C6H8ClN3O and a molecular weight of 173.60 g/mol. Its IUPAC name is 4-chloro-N,1-dimethylpyrazole-5-carboxamide.
| Compound Name | 4-chloro-N,1-dimethylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 17144538 |
| Molecular Formula | C6H8ClN3O |
| Molecular Weight | 173.60 g/mol |
| Exact Mass | 173.04 |
| IUPAC Name | 4-chloro-N,1-dimethylpyrazole-5-carboxamide |
| SMILES | CNC(=O)c1c(Cl)cnn1C |
| InChI | InChI=1S/C6H8ClN3O/c1-8-6(11)5-4(7)3-9-10(5)2/h3H,1-2H3,(H,8,11) |
| InChIKey | NVLCZVHXPBAMAN-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.60 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |