About 1-(4-chloro-1-methylpyrazol-5-yl)-2,2-difluoroethanone
1-(4-chloro-1-methylpyrazol-5-yl)-2,2-difluoroethanone (PubChem CID 114642247) has the molecular formula C6H5ClF2N2O
and a molecular weight of 194.57 g/mol. Its IUPAC name is 1-(4-chloro-1-methylpyrazol-5-yl)-2,2-difluoroethanone.
Analyze 1-(4-chloro-1-methylpyrazol-5-yl)-2,2-difluoroethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chloro-1-methylpyrazol-5-yl)-2,2-difluoroethanone?
The IUPAC name of 1-(4-chloro-1-methylpyrazol-5-yl)-2,2-difluoroethanone (CID 114642247) is 1-(4-chloro-1-methylpyrazol-5-yl)-2,2-difluoroethanone.
What is the SMILES notation for 1-(4-chloro-1-methylpyrazol-5-yl)-2,2-difluoroethanone?
The canonical SMILES for 1-(4-chloro-1-methylpyrazol-5-yl)-2,2-difluoroethanone is Cn1ncc(Cl)c1C(=O)C(F)F.
What is the InChIKey of 1-(4-chloro-1-methylpyrazol-5-yl)-2,2-difluoroethanone?
The InChIKey is AVVUQGMDCOFVRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5ClF2N2O/c1-11-4(3(7)2-10-11)5(12)6(8)9/h2,6H,1H3.
What are the key properties of 1-(4-chloro-1-methylpyrazol-5-yl)-2,2-difluoroethanone?
1-(4-chloro-1-methylpyrazol-5-yl)-2,2-difluoroethanone has a molecular weight of 194.57 g/mol, XLogP of 1.52, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chloro-1-methylpyrazol-5-yl)-2,2-difluoroethanone is sourced from PubChem (CID 114642247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).